C15H19N5O — CID 97346259
(2R)-N-benzyl-2-(1H-1,2,4-triazol-5-yl)piperidine-1-carboxamide (PubChem CID 97346259) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is (2R)-N-benzyl-2-(1H-1,2,4-triazol-5-yl)piperidine-1-carboxamide.
| Compound Name | (2R)-N-benzyl-2-(1H-1,2,4-triazol-5-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97346259 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (2R)-N-benzyl-2-(1H-1,2,4-triazol-5-yl)piperidine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCCC[C@@H]1c1ncn[nH]1 |
| InChI | InChI=1S/C15H19N5O/c21-15(16-10-12-6-2-1-3-7-12)20-9-5-4-8-13(20)14-17-11-18-19-14/h1-3,6-7,11,13H,4-5,8-10H2,(H,16,21)(H,17,18,19)/t13-/m1/s1 |
| InChIKey | JNCATWVOIQOXQT-CYBMUJFWSA-N |
| XLogP | 2.24 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |