C18H28N6O3S — CID 97346626
4-[4-[(3R)-1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]piperazin-1-yl]sulfonylbutanenitrile (PubChem CID 97346626) has the molecular formula C18H28N6O3S and a molecular weight of 408.53 g/mol. Its IUPAC name is 4-[4-[(3R)-1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]piperazin-1-yl]sulfonylbutanenitrile.
| Compound Name | 4-[4-[(3R)-1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]piperazin-1-yl]sulfonylbutanenitrile |
|---|---|
| PubChem CID | 97346626 |
| Molecular Formula | C18H28N6O3S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-[4-[(3R)-1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]piperazin-1-yl]sulfonylbutanenitrile |
| SMILES | Cc1cc(N2CCC[C@@H](N3CCN(S(=O)(=O)CCCC#N)CC3)C2=O)n(C)n1 |
| InChI | InChI=1S/C18H28N6O3S/c1-15-14-17(21(2)20-15)24-8-5-6-16(18(24)25)22-9-11-23(12-10-22)28(26,27)13-4-3-7-19/h14,16H,3-6,8-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | YBSXIZQRGLPTEA-MRXNPFEDSA-N |
| XLogP | 0.48 |
| TPSA | 102.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|