C20H27N3O4S — CID 97348821
(3R)-1-[2-[4-(cyanomethyl)phenoxy]acetyl]-N-cyclopentylpiperidine-3-sulfonamide (PubChem CID 97348821) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is (3R)-1-[2-[4-(cyanomethyl)phenoxy]acetyl]-N-cyclopentylpiperidine-3-sulfonamide.
| Compound Name | (3R)-1-[2-[4-(cyanomethyl)phenoxy]acetyl]-N-cyclopentylpiperidine-3-sulfonamide |
|---|---|
| PubChem CID | 97348821 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (3R)-1-[2-[4-(cyanomethyl)phenoxy]acetyl]-N-cyclopentylpiperidine-3-sulfonamide |
| SMILES | N#CCc1ccc(OCC(=O)N2CCC[C@@H](S(=O)(=O)NC3CCCC3)C2)cc1 |
| InChI | InChI=1S/C20H27N3O4S/c21-12-11-16-7-9-18(10-8-16)27-15-20(24)23-13-3-6-19(14-23)28(25,26)22-17-4-1-2-5-17/h7-10,17,19,22H,1-6,11,13-15H2/t19-/m1/s1 |
| InChIKey | YXOBWRQOFYNSRQ-LJQANCHMSA-N |
| XLogP | 1.98 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |