About N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide
N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide (PubChem CID 97349780) has the molecular formula C12H17F3N2O3S
and a molecular weight of 326.34 g/mol. Its IUPAC name is N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide |
| PubChem CID | 97349780 |
| Molecular Formula | C12H17F3N2O3S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide |
| SMILES | CC[C@@H](C)[C@H](O)CNS(=O)(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C12H17F3N2O3S/c1-3-8(2)10(18)7-17-21(19,20)9-4-5-11(16-6-9)12(13,14)15/h4-6,8,10,17-18H,3,7H2,1-2H3/t8-,10-/m1/s1 |
| InChIKey | BWYOOKXQVRTMRE-PSASIEDQSA-N |
| XLogP | 1.79 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide?
The IUPAC name of N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide (CID 97349780) is N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide.
What is the SMILES notation for N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide?
The canonical SMILES for N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide is CC[C@@H](C)[C@H](O)CNS(=O)(=O)c1ccc(C(F)(F)F)nc1.
What is the InChIKey of N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide?
The InChIKey is BWYOOKXQVRTMRE-PSASIEDQSA-N. The full InChI is InChI=1S/C12H17F3N2O3S/c1-3-8(2)10(18)7-17-21(19,20)9-4-5-11(16-6-9)12(13,14)15/h4-6,8,10,17-18H,3,7H2,1-2H3/t8-,10-/m1/s1.
What are the key properties of N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide?
N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide has a molecular weight of 326.34 g/mol, XLogP of 1.79, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,3R)-2-hydroxy-3-methylpentyl]-6-(trifluoromethyl)pyridine-3-sulfonamide is sourced from PubChem (CID 97349780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).