C13H18N2O2S — CID 97350493
methyl (3aR,6aR)-2-(1,3-thiazol-5-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate (PubChem CID 97350493) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is methyl (3aR,6aR)-2-(1,3-thiazol-5-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate.
| Compound Name | methyl (3aR,6aR)-2-(1,3-thiazol-5-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 97350493 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | methyl (3aR,6aR)-2-(1,3-thiazol-5-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylate |
| SMILES | COC(=O)[C@]12CCC[C@H]1CN(Cc1cncs1)C2 |
| InChI | InChI=1S/C13H18N2O2S/c1-17-12(16)13-4-2-3-10(13)6-15(8-13)7-11-5-14-9-18-11/h5,9-10H,2-4,6-8H2,1H3/t10-,13-/m0/s1 |
| InChIKey | ZJPINNYIJHGJJC-GWCFXTLKSA-N |
| XLogP | 1.92 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |