About 5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole
5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole (PubChem CID 97351268) has the molecular formula C11H20N4OS
and a molecular weight of 256.37 g/mol. Its IUPAC name is 5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole.
Molecular Properties
| Compound Name | 5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole |
| PubChem CID | 97351268 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole |
| SMILES | CO[C@@H]1CCC[C@@H]1Sc1nnnn1CC(C)C |
| InChI | InChI=1S/C11H20N4OS/c1-8(2)7-15-11(12-13-14-15)17-10-6-4-5-9(10)16-3/h8-10H,4-7H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | SBHPWUUZIYQEGP-ZJUUUORDSA-N |
| XLogP | 1.99 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole?
The IUPAC name of 5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole (CID 97351268) is 5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole.
What is the SMILES notation for 5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole?
The canonical SMILES for 5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole is CO[C@@H]1CCC[C@@H]1Sc1nnnn1CC(C)C.
What is the InChIKey of 5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole?
The InChIKey is SBHPWUUZIYQEGP-ZJUUUORDSA-N. The full InChI is InChI=1S/C11H20N4OS/c1-8(2)7-15-11(12-13-14-15)17-10-6-4-5-9(10)16-3/h8-10H,4-7H2,1-3H3/t9-,10+/m1/s1.
What are the key properties of 5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole?
5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole has a molecular weight of 256.37 g/mol, XLogP of 1.99, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1S,2R)-2-methoxycyclopentyl]sulfanyl-1-(2-methylpropyl)tetrazole is sourced from PubChem (CID 97351268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).