About 1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide
1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide (PubChem CID 97353102) has the molecular formula C18H22N4O2S
and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide |
| PubChem CID | 97353102 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide |
| SMILES | C[C@H]1CCC[C@@](C#N)(NS(=O)(=O)c2cnn(Cc3ccccc3)c2)C1 |
| InChI | InChI=1S/C18H22N4O2S/c1-15-6-5-9-18(10-15,14-19)21-25(23,24)17-11-20-22(13-17)12-16-7-3-2-4-8-16/h2-4,7-8,11,13,15,21H,5-6,9-10,12H2,1H3/t15-,18+/m0/s1 |
| InChIKey | UOTHHFFJLPENPT-MAUKXSAKSA-N |
| XLogP | 2.68 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide?
The IUPAC name of 1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide (CID 97353102) is 1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide.
What is the SMILES notation for 1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide?
The canonical SMILES for 1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide is C[C@H]1CCC[C@@](C#N)(NS(=O)(=O)c2cnn(Cc3ccccc3)c2)C1.
What is the InChIKey of 1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide?
The InChIKey is UOTHHFFJLPENPT-MAUKXSAKSA-N. The full InChI is InChI=1S/C18H22N4O2S/c1-15-6-5-9-18(10-15,14-19)21-25(23,24)17-11-20-22(13-17)12-16-7-3-2-4-8-16/h2-4,7-8,11,13,15,21H,5-6,9-10,12H2,1H3/t15-,18+/m0/s1.
What are the key properties of 1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide?
1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide has a molecular weight of 358.47 g/mol, XLogP of 2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-N-[(1R,3S)-1-cyano-3-methylcyclohexyl]pyrazole-4-sulfonamide is sourced from PubChem (CID 97353102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).