C33H38N4O4 — CID 97353969
(5S)-1,3-bis[2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 97353969) has the molecular formula C33H38N4O4 and a molecular weight of 554.69 g/mol. Its IUPAC name is (5S)-1,3-bis[2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-1,3-bis[2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97353969 |
| Molecular Formula | C33H38N4O4 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | (5S)-1,3-bis[2-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)[C@H](CCc3ccccc3)N(CC(=O)c3cc(C)n(C4CC4)c3C)C2=O)c(C)n1C1CC1 |
| InChI | InChI=1S/C33H38N4O4/c1-20-16-27(22(3)36(20)25-11-12-25)30(38)18-34-29(15-10-24-8-6-5-7-9-24)32(40)35(33(34)41)19-31(39)28-17-21(2)37(23(28)4)26-13-14-26/h5-9,16-17,25-26,29H,10-15,18-19H2,1-4H3/t29-/m0/s1 |
| InChIKey | XUIUCXQUWXJVHH-LJAQVGFWSA-N |
| XLogP | 5.52 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|