C35H28ClFN8O2 — CID 97354234
(17R)-17-(4-chloro-3-nitrophenyl)-9-[4-(4-fluorophenyl)piperazin-1-yl]-15-methyl-13-phenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaene (PubChem CID 97354234) has the molecular formula C35H28ClFN8O2 and a molecular weight of 647.11 g/mol. Its IUPAC name is (17R)-17-(4-chloro-3-nitrophenyl)-9-[4-(4-fluorophenyl)piperazin-1-yl]-15-methyl-13-phenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaene.
| Compound Name | (17R)-17-(4-chloro-3-nitrophenyl)-9-[4-(4-fluorophenyl)piperazin-1-yl]-15-methyl-13-phenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaene |
|---|---|
| PubChem CID | 97354234 |
| Molecular Formula | C35H28ClFN8O2 |
| Molecular Weight | 647.11 g/mol |
| Exact Mass | 646.20 |
| IUPAC Name | (17R)-17-(4-chloro-3-nitrophenyl)-9-[4-(4-fluorophenyl)piperazin-1-yl]-15-methyl-13-phenyl-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaene |
| SMILES | Cc1nn(-c2ccccc2)c2c1[C@@H](c1ccc(Cl)c([N+](=O)[O-])c1)N1C(=N2)C(N2CCN(c3ccc(F)cc3)CC2)=Nc2ccccc21 |
| InChI | InChI=1S/C35H28ClFN8O2/c1-22-31-32(23-11-16-27(36)30(21-23)45(46)47)43-29-10-6-5-9-28(29)38-34(35(43)39-33(31)44(40-22)26-7-3-2-4-8-26)42-19-17-41(18-20-42)25-14-12-24(37)13-15-25/h2-16,21,32H,17-20H2,1H3/t32-/m1/s1 |
| InChIKey | URYRAAZOMGDRHD-JGCGQSQUSA-N |
| XLogP | 7.39 |
| TPSA | 95.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.11 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|