C34H27ClN6O5S — CID 97354244
(17R)-17-(4-chloro-3-nitrophenyl)-15-methyl-13-[4-(4-propan-2-ylphenyl)sulfonylphenyl]-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one (PubChem CID 97354244) has the molecular formula C34H27ClN6O5S and a molecular weight of 667.15 g/mol. Its IUPAC name is (17R)-17-(4-chloro-3-nitrophenyl)-15-methyl-13-[4-(4-propan-2-ylphenyl)sulfonylphenyl]-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one.
| Compound Name | (17R)-17-(4-chloro-3-nitrophenyl)-15-methyl-13-[4-(4-propan-2-ylphenyl)sulfonylphenyl]-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one |
|---|---|
| PubChem CID | 97354244 |
| Molecular Formula | C34H27ClN6O5S |
| Molecular Weight | 667.15 g/mol |
| Exact Mass | 666.15 |
| IUPAC Name | (17R)-17-(4-chloro-3-nitrophenyl)-15-methyl-13-[4-(4-propan-2-ylphenyl)sulfonylphenyl]-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,10,12(16),14-hexaen-9-one |
| SMILES | Cc1nn(-c2ccc(S(=O)(=O)c3ccc(C(C)C)cc3)cc2)c2c1[C@@H](c1ccc(Cl)c([N+](=O)[O-])c1)N1C(=N2)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C34H27ClN6O5S/c1-19(2)21-8-13-24(14-9-21)47(45,46)25-15-11-23(12-16-25)40-32-30(20(3)38-40)31(22-10-17-26(35)29(18-22)41(43)44)39-28-7-5-4-6-27(28)36-34(42)33(39)37-32/h4-19,31H,1-3H3,(H,36,42)/t31-/m1/s1 |
| InChIKey | BRAWBYXCSATLIO-WJOKGBTCSA-N |
| XLogP | 7.29 |
| TPSA | 139.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.15 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|