C25H30N4 — CID 97355845
N-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-4-phenyldiazenylnaphthalen-1-amine (PubChem CID 97355845) has the molecular formula C25H30N4 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-4-phenyldiazenylnaphthalen-1-amine.
| Compound Name | N-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-4-phenyldiazenylnaphthalen-1-amine |
|---|---|
| PubChem CID | 97355845 |
| Molecular Formula | C25H30N4 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | N-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethyl]-4-phenyldiazenylnaphthalen-1-amine |
| SMILES | C[C@@H]1CCC[C@@H](C)N1CCNc1ccc(/N=N/c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C25H30N4/c1-19-9-8-10-20(2)29(19)18-17-26-24-15-16-25(23-14-7-6-13-22(23)24)28-27-21-11-4-3-5-12-21/h3-7,11-16,19-20,26H,8-10,17-18H2,1-2H3/b28-27+/t19-,20-/m1/s1 |
| InChIKey | WMWDEXXJQCOTEU-QBVLGXCHSA-N |
| XLogP | 6.93 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|