About (4-aminonaphthalen-1-yl) acetate
(4-aminonaphthalen-1-yl) acetate (PubChem CID 97355955) has the molecular formula C12H11NO2
and a molecular weight of 201.22 g/mol. Its IUPAC name is (4-aminonaphthalen-1-yl) acetate.
Molecular Properties
| Compound Name | (4-aminonaphthalen-1-yl) acetate |
| PubChem CID | 97355955 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | (4-aminonaphthalen-1-yl) acetate |
| SMILES | CC(=O)Oc1ccc(N)c2ccccc12 |
| InChI | InChI=1S/C12H11NO2/c1-8(14)15-12-7-6-11(13)9-4-2-3-5-10(9)12/h2-7H,13H2,1H3 |
| InChIKey | RQKMOUJASOVRPY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-aminonaphthalen-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminonaphthalen-1-yl) acetate?
The IUPAC name of (4-aminonaphthalen-1-yl) acetate (CID 97355955) is (4-aminonaphthalen-1-yl) acetate.
What is the SMILES notation for (4-aminonaphthalen-1-yl) acetate?
The canonical SMILES for (4-aminonaphthalen-1-yl) acetate is CC(=O)Oc1ccc(N)c2ccccc12.
What is the InChIKey of (4-aminonaphthalen-1-yl) acetate?
The InChIKey is RQKMOUJASOVRPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2/c1-8(14)15-12-7-6-11(13)9-4-2-3-5-10(9)12/h2-7H,13H2,1H3.
What are the key properties of (4-aminonaphthalen-1-yl) acetate?
(4-aminonaphthalen-1-yl) acetate has a molecular weight of 201.22 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminonaphthalen-1-yl) acetate is sourced from PubChem (CID 97355955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).