C17H25N3O2 — CID 97356248
(3S)-N-[3-(dimethylamino)propyl]-2-oxo-3-phenylpiperidine-3-carboxamide (PubChem CID 97356248) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (3S)-N-[3-(dimethylamino)propyl]-2-oxo-3-phenylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-(dimethylamino)propyl]-2-oxo-3-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 97356248 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (3S)-N-[3-(dimethylamino)propyl]-2-oxo-3-phenylpiperidine-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)[C@]1(c2ccccc2)CCCNC1=O |
| InChI | InChI=1S/C17H25N3O2/c1-20(2)13-7-12-19-16(22)17(10-6-11-18-15(17)21)14-8-4-3-5-9-14/h3-5,8-9H,6-7,10-13H2,1-2H3,(H,18,21)(H,19,22)/t17-/m0/s1 |
| InChIKey | HOCXPTTWTFMDJB-KRWDZBQOSA-N |
| XLogP | 0.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|