C16H21N — CID 97356467
(3aS,4R)-N-(cyclopropylmethyl)-1,2,3,3a,4,5-hexahydroacenaphthylen-4-amine (PubChem CID 97356467) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (3aS,4R)-N-(cyclopropylmethyl)-1,2,3,3a,4,5-hexahydroacenaphthylen-4-amine.
| Compound Name | (3aS,4R)-N-(cyclopropylmethyl)-1,2,3,3a,4,5-hexahydroacenaphthylen-4-amine |
|---|---|
| PubChem CID | 97356467 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (3aS,4R)-N-(cyclopropylmethyl)-1,2,3,3a,4,5-hexahydroacenaphthylen-4-amine |
| SMILES | c1cc2c3c(c1)C[C@H](NCC1CC1)C[C@@H]3CC2 |
| InChI | InChI=1S/C16H21N/c1-2-12-6-7-14-9-15(17-10-11-4-5-11)8-13(3-1)16(12)14/h1-3,11,14-15,17H,4-10H2/t14-,15-/m0/s1 |
| InChIKey | MVHPZMFHBAZRLZ-GJZGRUSLSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |