C18H28N2OS — CID 97356637
O-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethyl] N-(2,6-dimethylphenyl)carbamothioate (PubChem CID 97356637) has the molecular formula C18H28N2OS and a molecular weight of 320.50 g/mol. Its IUPAC name is O-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethyl] N-(2,6-dimethylphenyl)carbamothioate.
| Compound Name | O-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethyl] N-(2,6-dimethylphenyl)carbamothioate |
|---|---|
| PubChem CID | 97356637 |
| Molecular Formula | C18H28N2OS |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | O-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]ethyl] N-(2,6-dimethylphenyl)carbamothioate |
| SMILES | Cc1cccc(C)c1NC(=S)OCCN1[C@H](C)CCC[C@H]1C |
| InChI | InChI=1S/C18H28N2OS/c1-13-7-5-8-14(2)17(13)19-18(22)21-12-11-20-15(3)9-6-10-16(20)4/h5,7-8,15-16H,6,9-12H2,1-4H3,(H,19,22)/t15-,16-/m1/s1 |
| InChIKey | LOZHHARHRPPQGG-HZPDHXFCSA-N |
| XLogP | 4.28 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|