C6H11F2NO — CID 97357063
[(2S)-5,5-difluoropiperidin-2-yl]methanol (PubChem CID 97357063) has the molecular formula C6H11F2NO and a molecular weight of 151.16 g/mol. Its IUPAC name is [(2S)-5,5-difluoropiperidin-2-yl]methanol.
| Compound Name | [(2S)-5,5-difluoropiperidin-2-yl]methanol |
|---|---|
| PubChem CID | 97357063 |
| Molecular Formula | C6H11F2NO |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | [(2S)-5,5-difluoropiperidin-2-yl]methanol |
| SMILES | OC[C@@H]1CCC(F)(F)CN1 |
| InChI | InChI=1S/C6H11F2NO/c7-6(8)2-1-5(3-10)9-4-6/h5,9-10H,1-4H2/t5-/m0/s1 |
| InChIKey | QWVVJRSBGLPYHF-YFKPBYRVSA-N |
| XLogP | 0.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |