C8H9ClF3N — CID 97357216
(1R,2R,4R)-2-chloro-4-(trifluoromethyl)cyclohexane-1-carbonitrile (PubChem CID 97357216) has the molecular formula C8H9ClF3N and a molecular weight of 211.61 g/mol. Its IUPAC name is (1R,2R,4R)-2-chloro-4-(trifluoromethyl)cyclohexane-1-carbonitrile.
| Compound Name | (1R,2R,4R)-2-chloro-4-(trifluoromethyl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 97357216 |
| Molecular Formula | C8H9ClF3N |
| Molecular Weight | 211.61 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (1R,2R,4R)-2-chloro-4-(trifluoromethyl)cyclohexane-1-carbonitrile |
| SMILES | N#C[C@H]1CC[C@@H](C(F)(F)F)C[C@H]1Cl |
| InChI | InChI=1S/C8H9ClF3N/c9-7-3-6(8(10,11)12)2-1-5(7)4-13/h5-7H,1-3H2/t5-,6-,7-/m1/s1 |
| InChIKey | UVFDVBJURDSNHV-FSDSQADBSA-N |
| XLogP | 3.10 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|