C15H23N3O2 — CID 97357623
tert-butyl (3R,4R)-3-amino-4-pyridin-4-ylpiperidine-1-carboxylate (PubChem CID 97357623) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-amino-4-pyridin-4-ylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-amino-4-pyridin-4-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 97357623 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | tert-butyl (3R,4R)-3-amino-4-pyridin-4-ylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](c2ccncc2)[C@@H](N)C1 |
| InChI | InChI=1S/C15H23N3O2/c1-15(2,3)20-14(19)18-9-6-12(13(16)10-18)11-4-7-17-8-5-11/h4-5,7-8,12-13H,6,9-10,16H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | AGHANFLAWQUQJX-OLZOCXBDSA-N |
| XLogP | 2.13 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |