About (2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine
(2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine (PubChem CID 97358274) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is (2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine.
Molecular Properties
| Compound Name | (2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine |
| PubChem CID | 97358274 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine |
| SMILES | C[C@H]1CC(NC2CC2)C[C@H](C)O1 |
| InChI | InChI=1S/C10H19NO/c1-7-5-10(6-8(2)12-7)11-9-3-4-9/h7-11H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | QZMBOENVKRRVJU-YUMQZZPRSA-N |
| XLogP | 1.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine?
The IUPAC name of (2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine (CID 97358274) is (2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine.
What is the SMILES notation for (2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine?
The canonical SMILES for (2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine is C[C@H]1CC(NC2CC2)C[C@H](C)O1.
What is the InChIKey of (2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine?
The InChIKey is QZMBOENVKRRVJU-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H19NO/c1-7-5-10(6-8(2)12-7)11-9-3-4-9/h7-11H,3-6H2,1-2H3/t7-,8-/m0/s1.
What are the key properties of (2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine?
(2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine has a molecular weight of 169.27 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6S)-N-cyclopropyl-2,6-dimethyloxan-4-amine is sourced from PubChem (CID 97358274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).