C12H15F2N — CID 97358724
N-[(1R)-1-(2,4-difluorophenyl)ethyl]-2-methylprop-2-en-1-amine (PubChem CID 97358724) has the molecular formula C12H15F2N and a molecular weight of 211.25 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-difluorophenyl)ethyl]-2-methylprop-2-en-1-amine.
| Compound Name | N-[(1R)-1-(2,4-difluorophenyl)ethyl]-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 97358724 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | N-[(1R)-1-(2,4-difluorophenyl)ethyl]-2-methylprop-2-en-1-amine |
| SMILES | C=C(C)CN[C@H](C)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H15F2N/c1-8(2)7-15-9(3)11-5-4-10(13)6-12(11)14/h4-6,9,15H,1,7H2,2-3H3/t9-/m1/s1 |
| InChIKey | NHJDRZNOIFYIQP-SECBINFHSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|