About (2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane
(2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane (PubChem CID 97358958) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane.
Molecular Properties
| Compound Name | (2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane |
| PubChem CID | 97358958 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane |
| SMILES | C[C@H]1CCO[C@@H]([C@H]2OC2(C)C)C1 |
| InChI | InChI=1S/C10H18O2/c1-7-4-5-11-8(6-7)9-10(2,3)12-9/h7-9H,4-6H2,1-3H3/t7-,8+,9+/m0/s1 |
| InChIKey | WJXPSIYAXOVSRJ-DJLDLDEBSA-N |
| XLogP | 1.98 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane?
The IUPAC name of (2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane (CID 97358958) is (2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane.
What is the SMILES notation for (2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane?
The canonical SMILES for (2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane is C[C@H]1CCO[C@@H]([C@H]2OC2(C)C)C1.
What is the InChIKey of (2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane?
The InChIKey is WJXPSIYAXOVSRJ-DJLDLDEBSA-N. The full InChI is InChI=1S/C10H18O2/c1-7-4-5-11-8(6-7)9-10(2,3)12-9/h7-9H,4-6H2,1-3H3/t7-,8+,9+/m0/s1.
What are the key properties of (2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane?
(2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane has a molecular weight of 170.25 g/mol, XLogP of 1.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-2-[(2R)-3,3-dimethyloxiran-2-yl]-4-methyloxane is sourced from PubChem (CID 97358958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).