About (3S)-5,5-difluoropiperidin-3-ol
(3S)-5,5-difluoropiperidin-3-ol (PubChem CID 97359028) has the molecular formula C5H9F2NO
and a molecular weight of 137.13 g/mol. Its IUPAC name is (3S)-5,5-difluoropiperidin-3-ol.
Molecular Properties
| Compound Name | (3S)-5,5-difluoropiperidin-3-ol |
| PubChem CID | 97359028 |
| Molecular Formula | C5H9F2NO |
| Molecular Weight | 137.13 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | (3S)-5,5-difluoropiperidin-3-ol |
| SMILES | O[C@@H]1CNCC(F)(F)C1 |
| InChI | InChI=1S/C5H9F2NO/c6-5(7)1-4(9)2-8-3-5/h4,8-9H,1-3H2/t4-/m0/s1 |
| InChIKey | FWHFKCAGILQEMU-BYPYZUCNSA-N |
| XLogP | -0.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.13 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-5,5-difluoropiperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5,5-difluoropiperidin-3-ol?
The IUPAC name of (3S)-5,5-difluoropiperidin-3-ol (CID 97359028) is (3S)-5,5-difluoropiperidin-3-ol.
What is the SMILES notation for (3S)-5,5-difluoropiperidin-3-ol?
The canonical SMILES for (3S)-5,5-difluoropiperidin-3-ol is O[C@@H]1CNCC(F)(F)C1.
What is the InChIKey of (3S)-5,5-difluoropiperidin-3-ol?
The InChIKey is FWHFKCAGILQEMU-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H9F2NO/c6-5(7)1-4(9)2-8-3-5/h4,8-9H,1-3H2/t4-/m0/s1.
What are the key properties of (3S)-5,5-difluoropiperidin-3-ol?
(3S)-5,5-difluoropiperidin-3-ol has a molecular weight of 137.13 g/mol, XLogP of -0.02, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5,5-difluoropiperidin-3-ol is sourced from PubChem (CID 97359028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).