About (Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide
(Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide (PubChem CID 97359891) has the molecular formula C16H15NO2S
and a molecular weight of 285.37 g/mol. Its IUPAC name is (Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide.
Molecular Properties
| Compound Name | (Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide |
| PubChem CID | 97359891 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide |
| SMILES | O=C(/C=C\c1ccsc1)N[C@@H]1CCc2c(O)cccc21 |
| InChI | InChI=1S/C16H15NO2S/c18-15-3-1-2-12-13(15)5-6-14(12)17-16(19)7-4-11-8-9-20-10-11/h1-4,7-10,14,18H,5-6H2,(H,17,19)/b7-4-/t14-/m1/s1 |
| InChIKey | MYIXQDXIQNHHJK-HJHHMULASA-N |
| XLogP | 3.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide?
The IUPAC name of (Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide (CID 97359891) is (Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide.
What is the SMILES notation for (Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide?
The canonical SMILES for (Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide is O=C(/C=C\c1ccsc1)N[C@@H]1CCc2c(O)cccc21.
What is the InChIKey of (Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide?
The InChIKey is MYIXQDXIQNHHJK-HJHHMULASA-N. The full InChI is InChI=1S/C16H15NO2S/c18-15-3-1-2-12-13(15)5-6-14(12)17-16(19)7-4-11-8-9-20-10-11/h1-4,7-10,14,18H,5-6H2,(H,17,19)/b7-4-/t14-/m1/s1.
What are the key properties of (Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide?
(Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide has a molecular weight of 285.37 g/mol, XLogP of 3.27, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[(1R)-4-hydroxy-2,3-dihydro-1H-inden-1-yl]-3-thiophen-3-ylprop-2-enamide is sourced from PubChem (CID 97359891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).