C22H29N5O3 — CID 97360919
(6S)-N,N-diethyl-1'-(6-methylpyridine-2-carbonyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide (PubChem CID 97360919) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is (6S)-N,N-diethyl-1'-(6-methylpyridine-2-carbonyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide.
| Compound Name | (6S)-N,N-diethyl-1'-(6-methylpyridine-2-carbonyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide |
|---|---|
| PubChem CID | 97360919 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | (6S)-N,N-diethyl-1'-(6-methylpyridine-2-carbonyl)spiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-6-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1Cn2ccnc2C2(CCN(C(=O)c3cccc(C)n3)CC2)O1 |
| InChI | InChI=1S/C22H29N5O3/c1-4-25(5-2)20(29)18-15-27-14-11-23-21(27)22(30-18)9-12-26(13-10-22)19(28)17-8-6-7-16(3)24-17/h6-8,11,14,18H,4-5,9-10,12-13,15H2,1-3H3/t18-/m0/s1 |
| InChIKey | SBVPCHAIJGUOLT-SFHVURJKSA-N |
| XLogP | 1.99 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |