C17H25N3O4S — CID 97361162
N,N,2-trimethyl-1,1-dioxospiro[3,5-dihydro-6,1λ6,2-benzoxathiazocine-4,4'-piperidine]-1'-carboxamide (PubChem CID 97361162) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is N,N,2-trimethyl-1,1-dioxospiro[3,5-dihydro-6,1λ6,2-benzoxathiazocine-4,4'-piperidine]-1'-carboxamide.
| Compound Name | N,N,2-trimethyl-1,1-dioxospiro[3,5-dihydro-6,1λ6,2-benzoxathiazocine-4,4'-piperidine]-1'-carboxamide |
|---|---|
| PubChem CID | 97361162 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N,N,2-trimethyl-1,1-dioxospiro[3,5-dihydro-6,1λ6,2-benzoxathiazocine-4,4'-piperidine]-1'-carboxamide |
| SMILES | CN(C)C(=O)N1CCC2(CC1)COc1ccccc1S(=O)(=O)N(C)C2 |
| InChI | InChI=1S/C17H25N3O4S/c1-18(2)16(21)20-10-8-17(9-11-20)12-19(3)25(22,23)15-7-5-4-6-14(15)24-13-17/h4-7H,8-13H2,1-3H3 |
| InChIKey | GCDIORXXBMKTKA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |