C20H28N4O2 — CID 97361270
N-[3-(dimethylamino)propyl]-1-(2-methoxyethyl)-4-methylpyrrolo[3,2-b]indole-2-carboxamide (PubChem CID 97361270) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-1-(2-methoxyethyl)-4-methylpyrrolo[3,2-b]indole-2-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-1-(2-methoxyethyl)-4-methylpyrrolo[3,2-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 97361270 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-1-(2-methoxyethyl)-4-methylpyrrolo[3,2-b]indole-2-carboxamide |
| SMILES | COCCn1c(C(=O)NCCCN(C)C)cc2c1c1ccccc1n2C |
| InChI | InChI=1S/C20H28N4O2/c1-22(2)11-7-10-21-20(25)18-14-17-19(24(18)12-13-26-4)15-8-5-6-9-16(15)23(17)3/h5-6,8-9,14H,7,10-13H2,1-4H3,(H,21,25) |
| InChIKey | NXVBBZFDFFZKOI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|