C17H27N3O4 — CID 97362715
(3aR,7aR)-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-(2-methoxyethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide (PubChem CID 97362715) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is (3aR,7aR)-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-(2-methoxyethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide.
| Compound Name | (3aR,7aR)-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-(2-methoxyethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide |
|---|---|
| PubChem CID | 97362715 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (3aR,7aR)-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-(2-methoxyethyl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide |
| SMILES | COCCNC(=O)[C@@]12CCO[C@@H]1CCN(Cc1c(C)noc1C)C2 |
| InChI | InChI=1S/C17H27N3O4/c1-12-14(13(2)24-19-12)10-20-7-4-15-17(11-20,5-8-23-15)16(21)18-6-9-22-3/h15H,4-11H2,1-3H3,(H,18,21)/t15-,17-/m1/s1 |
| InChIKey | NGJUAROKDCMHBS-NVXWUHKLSA-N |
| XLogP | 1.04 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|