C17H25N3O2S — CID 97362731
[(3aR,7aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-pyrrolidin-1-ylmethanone (PubChem CID 97362731) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is [(3aR,7aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(3aR,7aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 97362731 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [(3aR,7aR)-5-[(4-methyl-1,3-thiazol-2-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]-pyrrolidin-1-ylmethanone |
| SMILES | Cc1csc(CN2CC[C@H]3OCC[C@@]3(C(=O)N3CCCC3)C2)n1 |
| InChI | InChI=1S/C17H25N3O2S/c1-13-11-23-15(18-13)10-19-8-4-14-17(12-19,5-9-22-14)16(21)20-6-2-3-7-20/h11,14H,2-10,12H2,1H3/t14-,17-/m1/s1 |
| InChIKey | GRSPCKALEAKPMS-RHSMWYFYSA-N |
| XLogP | 2.05 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |