C19H29N3O3 — CID 97362793
(3aR,7aR)-N-cyclopentyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide (PubChem CID 97362793) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is (3aR,7aR)-N-cyclopentyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide.
| Compound Name | (3aR,7aR)-N-cyclopentyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide |
|---|---|
| PubChem CID | 97362793 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (3aR,7aR)-N-cyclopentyl-5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide |
| SMILES | Cc1noc(C)c1CN1CC[C@H]2OCC[C@@]2(C(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C19H29N3O3/c1-13-16(14(2)25-21-13)11-22-9-7-17-19(12-22,8-10-24-17)18(23)20-15-5-3-4-6-15/h15,17H,3-12H2,1-2H3,(H,20,23)/t17-,19-/m1/s1 |
| InChIKey | RYRMSHIOLNGZMC-IEBWSBKVSA-N |
| XLogP | 2.33 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |