C17H25N3O2S — CID 97362893
(3aS,4S,7aS)-N-cyclopentyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide (PubChem CID 97362893) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is (3aS,4S,7aS)-N-cyclopentyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide.
| Compound Name | (3aS,4S,7aS)-N-cyclopentyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 97362893 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (3aS,4S,7aS)-N-cyclopentyl-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide |
| SMILES | O=C(NC1CCCC1)[C@@H]1CN(Cc2nccs2)C[C@H]2OCC[C@H]21 |
| InChI | InChI=1S/C17H25N3O2S/c21-17(19-12-3-1-2-4-12)14-9-20(11-16-18-6-8-23-16)10-15-13(14)5-7-22-15/h6,8,12-15H,1-5,7,9-11H2,(H,19,21)/t13-,14+,15+/m0/s1 |
| InChIKey | MPSAAZCUSFRURR-RRFJBIMHSA-N |
| XLogP | 2.04 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |