C13H26N2O4S — CID 97363449
(4aR,8aS)-4a-(ethoxymethyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-sulfonamide (PubChem CID 97363449) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is (4aR,8aS)-4a-(ethoxymethyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-sulfonamide.
| Compound Name | (4aR,8aS)-4a-(ethoxymethyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-sulfonamide |
|---|---|
| PubChem CID | 97363449 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (4aR,8aS)-4a-(ethoxymethyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-sulfonamide |
| SMILES | CCOC[C@]12CCCO[C@H]1CCN(S(=O)(=O)N(C)C)C2 |
| InChI | InChI=1S/C13H26N2O4S/c1-4-18-11-13-7-5-9-19-12(13)6-8-15(10-13)20(16,17)14(2)3/h12H,4-11H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | PAUBPSZNHZTOGW-QWHCGFSZSA-N |
| XLogP | 0.70 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |