C17H27N3OS — CID 97364507
(4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrrolidin-1-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine (PubChem CID 97364507) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is (4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrrolidin-1-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine.
| Compound Name | (4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrrolidin-1-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine |
|---|---|
| PubChem CID | 97364507 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (4aS,8R,8aS)-6-[(4-methyl-1,3-thiazol-2-yl)methyl]-8-pyrrolidin-1-yl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine |
| SMILES | Cc1csc(CN2C[C@@H]3CCCO[C@@H]3[C@H](N3CCCC3)C2)n1 |
| InChI | InChI=1S/C17H27N3OS/c1-13-12-22-16(18-13)11-19-9-14-5-4-8-21-17(14)15(10-19)20-6-2-3-7-20/h12,14-15,17H,2-11H2,1H3/t14-,15+,17-/m0/s1 |
| InChIKey | XWYNCXRXTBWZNC-UXLLHSPISA-N |
| XLogP | 2.53 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |