C16H24N2O3S — CID 97364531
N-[(4aS,8R,8aS)-6-benzyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide (PubChem CID 97364531) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is N-[(4aS,8R,8aS)-6-benzyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide.
| Compound Name | N-[(4aS,8R,8aS)-6-benzyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 97364531 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[(4aS,8R,8aS)-6-benzyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CN(Cc2ccccc2)C[C@@H]2CCCO[C@@H]21 |
| InChI | InChI=1S/C16H24N2O3S/c1-22(19,20)17-15-12-18(10-13-6-3-2-4-7-13)11-14-8-5-9-21-16(14)15/h2-4,6-7,14-17H,5,8-12H2,1H3/t14-,15+,16-/m0/s1 |
| InChIKey | NXOJMAPIISMWEO-XHSDSOJGSA-N |
| XLogP | 1.22 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |