C15H23N3O3S — CID 97364534
N-[(4aS,8R,8aS)-6-(pyridin-4-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide (PubChem CID 97364534) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is N-[(4aS,8R,8aS)-6-(pyridin-4-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide.
| Compound Name | N-[(4aS,8R,8aS)-6-(pyridin-4-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 97364534 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-[(4aS,8R,8aS)-6-(pyridin-4-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CN(Cc2ccncc2)C[C@@H]2CCCO[C@@H]21 |
| InChI | InChI=1S/C15H23N3O3S/c1-22(19,20)17-14-11-18(9-12-4-6-16-7-5-12)10-13-3-2-8-21-15(13)14/h4-7,13-15,17H,2-3,8-11H2,1H3/t13-,14+,15-/m0/s1 |
| InChIKey | AJJFOZLSCJJAPI-ZNMIVQPWSA-N |
| XLogP | 0.61 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |