C12H11ClFN3O2 — CID 973646
1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethyl-4-nitropyrazole (PubChem CID 973646) has the molecular formula C12H11ClFN3O2 and a molecular weight of 283.69 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethyl-4-nitropyrazole.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethyl-4-nitropyrazole |
|---|---|
| PubChem CID | 973646 |
| Molecular Formula | C12H11ClFN3O2 |
| Molecular Weight | 283.69 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methyl]-3,5-dimethyl-4-nitropyrazole |
| SMILES | Cc1nn(Cc2ccc(F)cc2Cl)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11ClFN3O2/c1-7-12(17(18)19)8(2)16(15-7)6-9-3-4-10(14)5-11(9)13/h3-5H,6H2,1-2H3 |
| InChIKey | ZQFKLQJYTWYOLD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.69 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|