C19H26N4O2 — CID 97364611
(4aS,8R,8aS)-6-(furan-2-ylmethyl)-N-methyl-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine (PubChem CID 97364611) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (4aS,8R,8aS)-6-(furan-2-ylmethyl)-N-methyl-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine.
| Compound Name | (4aS,8R,8aS)-6-(furan-2-ylmethyl)-N-methyl-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine |
|---|---|
| PubChem CID | 97364611 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (4aS,8R,8aS)-6-(furan-2-ylmethyl)-N-methyl-N-(pyrimidin-5-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-amine |
| SMILES | CN(Cc1cncnc1)[C@@H]1CN(Cc2ccco2)C[C@@H]2CCCO[C@@H]21 |
| InChI | InChI=1S/C19H26N4O2/c1-22(10-15-8-20-14-21-9-15)18-13-23(12-17-5-3-6-24-17)11-16-4-2-7-25-19(16)18/h3,5-6,8-9,14,16,18-19H,2,4,7,10-13H2,1H3/t16-,18+,19-/m0/s1 |
| InChIKey | WAYGVQOMXPNYJV-UHOSZYNNSA-N |
| XLogP | 2.18 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |