C16H24N4O3 — CID 97364615
(3aR,7R,7aR)-2-(6-methoxypyrimidin-4-yl)-N-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide (PubChem CID 97364615) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (3aR,7R,7aR)-2-(6-methoxypyrimidin-4-yl)-N-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide.
| Compound Name | (3aR,7R,7aR)-2-(6-methoxypyrimidin-4-yl)-N-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
|---|---|
| PubChem CID | 97364615 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (3aR,7R,7aR)-2-(6-methoxypyrimidin-4-yl)-N-propan-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
| SMILES | COc1cc(N2C[C@@H]3COC[C@H](C(=O)NC(C)C)[C@@H]3C2)ncn1 |
| InChI | InChI=1S/C16H24N4O3/c1-10(2)19-16(21)13-8-23-7-11-5-20(6-12(11)13)14-4-15(22-3)18-9-17-14/h4,9-13H,5-8H2,1-3H3,(H,19,21)/t11-,12-,13+/m1/s1 |
| InChIKey | SRQSKZWBPMXQIG-UPJWGTAASA-N |
| XLogP | 0.71 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |