C18H21N5O2 — CID 97364673
(3aR,7R,7aR)-N-(pyridin-2-ylmethyl)-2-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide (PubChem CID 97364673) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is (3aR,7R,7aR)-N-(pyridin-2-ylmethyl)-2-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide.
| Compound Name | (3aR,7R,7aR)-N-(pyridin-2-ylmethyl)-2-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
|---|---|
| PubChem CID | 97364673 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (3aR,7R,7aR)-N-(pyridin-2-ylmethyl)-2-pyrimidin-2-yl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-7-carboxamide |
| SMILES | O=C(NCc1ccccn1)[C@H]1COC[C@H]2CN(c3ncccn3)C[C@H]21 |
| InChI | InChI=1S/C18H21N5O2/c24-17(22-8-14-4-1-2-5-19-14)16-12-25-11-13-9-23(10-15(13)16)18-20-6-3-7-21-18/h1-7,13,15-16H,8-12H2,(H,22,24)/t13-,15-,16+/m1/s1 |
| InChIKey | NOPXZTJADXCHHE-BMFZPTHFSA-N |
| XLogP | 0.89 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |