C17H24N4O4 — CID 97364691
[(3aR,7R,7aR)-2-(6-methoxypyrimidin-4-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone (PubChem CID 97364691) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is [(3aR,7R,7aR)-2-(6-methoxypyrimidin-4-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone.
| Compound Name | [(3aR,7R,7aR)-2-(6-methoxypyrimidin-4-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone |
|---|---|
| PubChem CID | 97364691 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | [(3aR,7R,7aR)-2-(6-methoxypyrimidin-4-yl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone |
| SMILES | COc1cc(N2C[C@@H]3COC[C@H](C(=O)N4CCCCO4)[C@@H]3C2)ncn1 |
| InChI | InChI=1S/C17H24N4O4/c1-23-16-6-15(18-11-19-16)20-7-12-9-24-10-14(13(12)8-20)17(22)21-4-2-3-5-25-21/h6,11-14H,2-5,7-10H2,1H3/t12-,13-,14+/m1/s1 |
| InChIKey | UDOCWUSQKCOJMX-MCIONIFRSA-N |
| XLogP | 0.74 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |