C17H25N3O4 — CID 97364695
[(3aR,7R,7aR)-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone (PubChem CID 97364695) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is [(3aR,7R,7aR)-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone.
| Compound Name | [(3aR,7R,7aR)-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone |
|---|---|
| PubChem CID | 97364695 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | [(3aR,7R,7aR)-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-(oxazinan-2-yl)methanone |
| SMILES | Cc1cc(CN2C[C@@H]3COC[C@H](C(=O)N4CCCCO4)[C@@H]3C2)no1 |
| InChI | InChI=1S/C17H25N3O4/c1-12-6-14(18-24-12)8-19-7-13-10-22-11-16(15(13)9-19)17(21)20-4-2-3-5-23-20/h6,13,15-16H,2-5,7-11H2,1H3/t13-,15-,16+/m1/s1 |
| InChIKey | JLSMHNPNKFAUDM-BMFZPTHFSA-N |
| XLogP | 1.23 |
| TPSA | 68.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |