C17H23N3O2 — CID 97365100
(3aR,6S,7aR)-N-cyclopropyl-4-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide (PubChem CID 97365100) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (3aR,6S,7aR)-N-cyclopropyl-4-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide.
| Compound Name | (3aR,6S,7aR)-N-cyclopropyl-4-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 97365100 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (3aR,6S,7aR)-N-cyclopropyl-4-(pyridin-3-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
| SMILES | O=C(NC1CC1)[C@H]1C[C@H]2OCC[C@H]2N(Cc2cccnc2)C1 |
| InChI | InChI=1S/C17H23N3O2/c21-17(19-14-3-4-14)13-8-16-15(5-7-22-16)20(11-13)10-12-2-1-6-18-9-12/h1-2,6,9,13-16H,3-5,7-8,10-11H2,(H,19,21)/t13-,15+,16+/m0/s1 |
| InChIKey | WAVVEYLCGGQDGI-NUEKZKHPSA-N |
| XLogP | 1.34 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |