C16H22N2O4 — CID 97365111
[(3aR,6S,7aR)-4-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-6-yl]-(1,2-oxazolidin-2-yl)methanone (PubChem CID 97365111) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is [(3aR,6S,7aR)-4-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-6-yl]-(1,2-oxazolidin-2-yl)methanone.
| Compound Name | [(3aR,6S,7aR)-4-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-6-yl]-(1,2-oxazolidin-2-yl)methanone |
|---|---|
| PubChem CID | 97365111 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | [(3aR,6S,7aR)-4-(furan-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-6-yl]-(1,2-oxazolidin-2-yl)methanone |
| SMILES | O=C([C@H]1C[C@H]2OCC[C@H]2N(Cc2ccco2)C1)N1CCCO1 |
| InChI | InChI=1S/C16H22N2O4/c19-16(18-5-2-7-22-18)12-9-15-14(4-8-21-15)17(10-12)11-13-3-1-6-20-13/h1,3,6,12,14-15H,2,4-5,7-11H2/t12-,14+,15+/m0/s1 |
| InChIKey | ULHDQOKVJDCEPB-NWANDNLSSA-N |
| XLogP | 1.42 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |