C16H17FN6O2 — CID 97365147
(3aR,6S,7aR)-4-(5-fluoropyrimidin-2-yl)-N-pyrazin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide (PubChem CID 97365147) has the molecular formula C16H17FN6O2 and a molecular weight of 344.35 g/mol. Its IUPAC name is (3aR,6S,7aR)-4-(5-fluoropyrimidin-2-yl)-N-pyrazin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide.
| Compound Name | (3aR,6S,7aR)-4-(5-fluoropyrimidin-2-yl)-N-pyrazin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 97365147 |
| Molecular Formula | C16H17FN6O2 |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (3aR,6S,7aR)-4-(5-fluoropyrimidin-2-yl)-N-pyrazin-2-yl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-6-carboxamide |
| SMILES | O=C(Nc1cnccn1)[C@H]1C[C@H]2OCC[C@H]2N(c2ncc(F)cn2)C1 |
| InChI | InChI=1S/C16H17FN6O2/c17-11-6-20-16(21-7-11)23-9-10(5-13-12(23)1-4-25-13)15(24)22-14-8-18-2-3-19-14/h2-3,6-8,10,12-13H,1,4-5,9H2,(H,19,22,24)/t10-,12+,13+/m0/s1 |
| InChIKey | URNVANPMJPJFLS-CYZMBNFOSA-N |
| XLogP | 1.03 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |