C14H25NO4S — CID 97365316
(4aS,7R,7aR)-4-cyclopropylsulfonyl-7-(2-methylpropoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 97365316) has the molecular formula C14H25NO4S and a molecular weight of 303.42 g/mol. Its IUPAC name is (4aS,7R,7aR)-4-cyclopropylsulfonyl-7-(2-methylpropoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aS,7R,7aR)-4-cyclopropylsulfonyl-7-(2-methylpropoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 97365316 |
| Molecular Formula | C14H25NO4S |
| Molecular Weight | 303.42 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (4aS,7R,7aR)-4-cyclopropylsulfonyl-7-(2-methylpropoxy)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | CC(C)CO[C@@H]1CC[C@H]2[C@H]1OCCN2S(=O)(=O)C1CC1 |
| InChI | InChI=1S/C14H25NO4S/c1-10(2)9-19-13-6-5-12-14(13)18-8-7-15(12)20(16,17)11-3-4-11/h10-14H,3-9H2,1-2H3/t12-,13+,14+/m0/s1 |
| InChIKey | HOEMGJIBNXYMNY-BFHYXJOUSA-N |
| XLogP | 1.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |