C15H21FN4O3 — CID 97365392
2-[[(4aS,7R,7aR)-4-(5-fluoropyrimidin-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-N,N-dimethylacetamide (PubChem CID 97365392) has the molecular formula C15H21FN4O3 and a molecular weight of 324.36 g/mol. Its IUPAC name is 2-[[(4aS,7R,7aR)-4-(5-fluoropyrimidin-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-N,N-dimethylacetamide.
| Compound Name | 2-[[(4aS,7R,7aR)-4-(5-fluoropyrimidin-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 97365392 |
| Molecular Formula | C15H21FN4O3 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-[[(4aS,7R,7aR)-4-(5-fluoropyrimidin-2-yl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CO[C@@H]1CC[C@H]2[C@H]1OCCN2c1ncc(F)cn1 |
| InChI | InChI=1S/C15H21FN4O3/c1-19(2)13(21)9-23-12-4-3-11-14(12)22-6-5-20(11)15-17-7-10(16)8-18-15/h7-8,11-12,14H,3-6,9H2,1-2H3/t11-,12+,14+/m0/s1 |
| InChIKey | KDGQLCPUQHAIAM-OUCADQQQSA-N |
| XLogP | 0.46 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |