C14H21N3O4S — CID 97365527
(4aS,7R,7aR)-N,N-dimethyl-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-sulfonamide (PubChem CID 97365527) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is (4aS,7R,7aR)-N,N-dimethyl-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-sulfonamide.
| Compound Name | (4aS,7R,7aR)-N,N-dimethyl-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-sulfonamide |
|---|---|
| PubChem CID | 97365527 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (4aS,7R,7aR)-N,N-dimethyl-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCO[C@H]2[C@H](Oc3cccnc3)CC[C@@H]21 |
| InChI | InChI=1S/C14H21N3O4S/c1-16(2)22(18,19)17-8-9-20-14-12(17)5-6-13(14)21-11-4-3-7-15-10-11/h3-4,7,10,12-14H,5-6,8-9H2,1-2H3/t12-,13+,14+/m0/s1 |
| InChIKey | HKTOHRXVLKHQSE-BFHYXJOUSA-N |
| XLogP | 0.50 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |