C17H24N2O2 — CID 97365528
(4aS,7R,7aR)-4-cyclopentyl-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 97365528) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (4aS,7R,7aR)-4-cyclopentyl-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aS,7R,7aR)-4-cyclopentyl-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 97365528 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (4aS,7R,7aR)-4-cyclopentyl-7-pyridin-3-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | c1cncc(O[C@@H]2CC[C@H]3[C@H]2OCCN3C2CCCC2)c1 |
| InChI | InChI=1S/C17H24N2O2/c1-2-5-13(4-1)19-10-11-20-17-15(19)7-8-16(17)21-14-6-3-9-18-12-14/h3,6,9,12-13,15-17H,1-2,4-5,7-8,10-11H2/t15-,16+,17+/m0/s1 |
| InChIKey | ZYJJHYIVOPHMGE-GVDBMIGSSA-N |
| XLogP | 2.63 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |