C18H32N2O2 — CID 97365907
(4aS,7S,7aR)-7-(cyclopropylmethoxy)-4-(2-piperidin-1-ylethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 97365907) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is (4aS,7S,7aR)-7-(cyclopropylmethoxy)-4-(2-piperidin-1-ylethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aS,7S,7aR)-7-(cyclopropylmethoxy)-4-(2-piperidin-1-ylethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 97365907 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | (4aS,7S,7aR)-7-(cyclopropylmethoxy)-4-(2-piperidin-1-ylethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | C1CCN(CCN2CCO[C@H]3[C@@H](OCC4CC4)CC[C@@H]32)CC1 |
| InChI | InChI=1S/C18H32N2O2/c1-2-8-19(9-3-1)10-11-20-12-13-21-18-16(20)6-7-17(18)22-14-15-4-5-15/h15-18H,1-14H2/t16-,17-,18+/m0/s1 |
| InChIKey | OJZXKKGWCJAELF-OKZBNKHCSA-N |
| XLogP | 2.13 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |