C18H22N2O3 — CID 97366086
[(4aS,7S,7aR)-7-pyridin-2-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(cyclopenten-1-yl)methanone (PubChem CID 97366086) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is [(4aS,7S,7aR)-7-pyridin-2-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(cyclopenten-1-yl)methanone.
| Compound Name | [(4aS,7S,7aR)-7-pyridin-2-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(cyclopenten-1-yl)methanone |
|---|---|
| PubChem CID | 97366086 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [(4aS,7S,7aR)-7-pyridin-2-yloxy-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(cyclopenten-1-yl)methanone |
| SMILES | O=C(C1=CCCC1)N1CCO[C@H]2[C@@H](Oc3ccccn3)CC[C@@H]21 |
| InChI | InChI=1S/C18H22N2O3/c21-18(13-5-1-2-6-13)20-11-12-22-17-14(20)8-9-15(17)23-16-7-3-4-10-19-16/h3-5,7,10,14-15,17H,1-2,6,8-9,11-12H2/t14-,15-,17+/m0/s1 |
| InChIKey | HJYVCJBUXKLBHR-YQQAZPJKSA-N |
| XLogP | 2.33 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |