C18H23N3O2S — CID 97366329
(3R,3aS,7aR)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-(pyridin-2-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 97366329) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is (3R,3aS,7aR)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-(pyridin-2-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3R,3aS,7aR)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-(pyridin-2-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97366329 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (3R,3aS,7aR)-1-[(4-methyl-1,3-thiazol-5-yl)methyl]-3-(pyridin-2-ylmethoxy)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | Cc1ncsc1CN1C[C@@H](OCc2ccccn2)[C@H]2OCCC[C@H]21 |
| InChI | InChI=1S/C18H23N3O2S/c1-13-17(24-12-20-13)10-21-9-16(18-15(21)6-4-8-22-18)23-11-14-5-2-3-7-19-14/h2-3,5,7,12,15-16,18H,4,6,8-11H2,1H3/t15-,16-,18+/m1/s1 |
| InChIKey | NJADOERGYDHRNC-NUJGCVRESA-N |
| XLogP | 2.80 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |